C15H13ClNO2- — CID 7148181
(2R)-2-(4-chlorophenyl)-2-(2-methylanilino)acetate (PubChem CID 7148181) has the molecular formula C15H13ClNO2- and a molecular weight of 274.73 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-2-(2-methylanilino)acetate.
| Compound Name | (2R)-2-(4-chlorophenyl)-2-(2-methylanilino)acetate |
|---|---|
| PubChem CID | 7148181 |
| Molecular Formula | C15H13ClNO2- |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-2-(2-methylanilino)acetate |
| SMILES | Cc1ccccc1N[C@@H](C(=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO2/c1-10-4-2-3-5-13(10)17-14(15(18)19)11-6-8-12(16)9-7-11/h2-9,14,17H,1H3,(H,18,19)/p-1/t14-/m1/s1 |
| InChIKey | LZQMKXDZAKBCSJ-CQSZACIVSA-M |
| XLogP | 2.55 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |