C21H39N3O4SSi3 — CID 71482199
[(2R,3S,4S,5R,6S)-2-(azidomethyl)-6-phenylsulfanyl-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane (PubChem CID 71482199) has the molecular formula C21H39N3O4SSi3 and a molecular weight of 513.89 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-2-(azidomethyl)-6-phenylsulfanyl-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3S,4S,5R,6S)-2-(azidomethyl)-6-phenylsulfanyl-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 71482199 |
| Molecular Formula | C21H39N3O4SSi3 |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-2-(azidomethyl)-6-phenylsulfanyl-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@H](CN=[N+]=[N-])O[C@@H](Sc2ccccc2)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H39N3O4SSi3/c1-30(2,3)26-18-17(15-23-24-22)25-21(29-16-13-11-10-12-14-16)20(28-32(7,8)9)19(18)27-31(4,5)6/h10-14,17-21H,15H2,1-9H3/t17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | DGNWRBBCLDJPIN-IFLJBQAJSA-N |
| XLogP | 6.47 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|