C9H12O4 — CID 71482459
(4S,5S,6S)-4,5,6-trihydroxy-6-prop-2-enylcyclohex-2-en-1-one (PubChem CID 71482459) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (4S,5S,6S)-4,5,6-trihydroxy-6-prop-2-enylcyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-4,5,6-trihydroxy-6-prop-2-enylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 71482459 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (4S,5S,6S)-4,5,6-trihydroxy-6-prop-2-enylcyclohex-2-en-1-one |
| SMILES | C=CC[C@@]1(O)C(=O)C=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12O4/c1-2-5-9(13)7(11)4-3-6(10)8(9)12/h2-4,6,8,10,12-13H,1,5H2/t6-,8-,9+/m0/s1 |
| InChIKey | LJQRWKNEBPRFJV-CNUIFLNQSA-N |
| XLogP | -0.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|