C14H16FN3OS — CID 71482579
S-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl] N,N-dimethylcarbamothioate (PubChem CID 71482579) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is S-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 71482579 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | S-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)SC(c1cccc(F)c1)c1nccn1C |
| InChI | InChI=1S/C14H16FN3OS/c1-17(2)14(19)20-12(13-16-7-8-18(13)3)10-5-4-6-11(15)9-10/h4-9,12H,1-3H3 |
| InChIKey | JFDRMAIFSMMKHJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|