C14H14Cl4N4O — CID 71483305
1-(4-methylpiperazin-1-yl)-2-(4,5,6,7-tetrachlorobenzimidazol-1-yl)ethanone (PubChem CID 71483305) has the molecular formula C14H14Cl4N4O and a molecular weight of 396.11 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-(4,5,6,7-tetrachlorobenzimidazol-1-yl)ethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-(4,5,6,7-tetrachlorobenzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 71483305 |
| Molecular Formula | C14H14Cl4N4O |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-(4,5,6,7-tetrachlorobenzimidazol-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)Cn2cnc3c(Cl)c(Cl)c(Cl)c(Cl)c32)CC1 |
| InChI | InChI=1S/C14H14Cl4N4O/c1-20-2-4-21(5-3-20)8(23)6-22-7-19-13-11(17)9(15)10(16)12(18)14(13)22/h7H,2-6H2,1H3 |
| InChIKey | CDKFMHWAYXWGEI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|