C26H33NO2 — CID 71483476
(2R,3aS,7S)-3a-pent-4-enyl-2-phenyl-7-(phenylmethoxymethyl)-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine (PubChem CID 71483476) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (2R,3aS,7S)-3a-pent-4-enyl-2-phenyl-7-(phenylmethoxymethyl)-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine.
| Compound Name | (2R,3aS,7S)-3a-pent-4-enyl-2-phenyl-7-(phenylmethoxymethyl)-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine |
|---|---|
| PubChem CID | 71483476 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (2R,3aS,7S)-3a-pent-4-enyl-2-phenyl-7-(phenylmethoxymethyl)-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine |
| SMILES | C=CCCC[C@@]12CCC[C@@H](COCc3ccccc3)N1O[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C26H33NO2/c1-2-3-10-17-26-18-11-16-24(21-28-20-22-12-6-4-7-13-22)27(26)29-25(19-26)23-14-8-5-9-15-23/h2,4-9,12-15,24-25H,1,3,10-11,16-21H2/t24-,25+,26-/m0/s1 |
| InChIKey | DQFRTIIUKBIJJM-NXCFDTQHSA-N |
| XLogP | 6.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|