C21H27N3O4 — CID 71483836
N'-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)heptanediamide (PubChem CID 71483836) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N'-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)heptanediamide.
| Compound Name | N'-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)heptanediamide |
|---|---|
| PubChem CID | 71483836 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N'-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)heptanediamide |
| SMILES | COc1ccc(NC(=O)CCCCCC(=O)Nc2cccc(N)c2)cc1OC |
| InChI | InChI=1S/C21H27N3O4/c1-27-18-12-11-17(14-19(18)28-2)24-21(26)10-5-3-4-9-20(25)23-16-8-6-7-15(22)13-16/h6-8,11-14H,3-5,9-10,22H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | MVIQWEXWVFHVCJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|