C21H25N3O6 — CID 71484289
(2R,3R,4S,5S)-2-[(2R)-2-azido-1-hydroxy-3-phenylmethoxypropan-2-yl]-5-phenylmethoxyoxolane-3,4-diol (PubChem CID 71484289) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[(2R)-2-azido-1-hydroxy-3-phenylmethoxypropan-2-yl]-5-phenylmethoxyoxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[(2R)-2-azido-1-hydroxy-3-phenylmethoxypropan-2-yl]-5-phenylmethoxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 71484289 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R,3R,4S,5S)-2-[(2R)-2-azido-1-hydroxy-3-phenylmethoxypropan-2-yl]-5-phenylmethoxyoxolane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@](CO)(COCc1ccccc1)[C@H]1O[C@H](OCc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H25N3O6/c22-24-23-21(13-25,14-28-11-15-7-3-1-4-8-15)19-17(26)18(27)20(30-19)29-12-16-9-5-2-6-10-16/h1-10,17-20,25-27H,11-14H2/t17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | MYULKWLZICTXFZ-NXNFSMPISA-N |
| XLogP | 1.91 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|