C20H38O5Si — CID 71484357
ethyl (E,4R,5R,6S)-7-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-2-enoate (PubChem CID 71484357) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is ethyl (E,4R,5R,6S)-7-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-2-enoate.
| Compound Name | ethyl (E,4R,5R,6S)-7-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-2-enoate |
|---|---|
| PubChem CID | 71484357 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | ethyl (E,4R,5R,6S)-7-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COC(C)=O |
| InChI | InChI=1S/C20H38O5Si/c1-11-23-19(22)15(3)12-14(2)18(16(4)13-24-17(5)21)25-26(9,10)20(6,7)8/h12,14,16,18H,11,13H2,1-10H3/b15-12+/t14-,16+,18-/m1/s1 |
| InChIKey | HUSAUPBYLQHAQT-CASTWZNYSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|