C20H28Cl2N4S — CID 71484435
N'-[1-[4-(methylamino)cyclohexyl]-2,3-dihydroindol-5-yl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 71484435) has the molecular formula C20H28Cl2N4S and a molecular weight of 427.45 g/mol. Its IUPAC name is N'-[1-[4-(methylamino)cyclohexyl]-2,3-dihydroindol-5-yl]thiophene-2-carboximidamide;dihydrochloride.
| Compound Name | N'-[1-[4-(methylamino)cyclohexyl]-2,3-dihydroindol-5-yl]thiophene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 71484435 |
| Molecular Formula | C20H28Cl2N4S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N'-[1-[4-(methylamino)cyclohexyl]-2,3-dihydroindol-5-yl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | CNC1CCC(N2CCc3cc(/N=C(\N)c4cccs4)ccc32)CC1.Cl.Cl |
| InChI | InChI=1S/C20H26N4S.2ClH/c1-22-15-4-7-17(8-5-15)24-11-10-14-13-16(6-9-18(14)24)23-20(21)19-3-2-12-25-19;;/h2-3,6,9,12-13,15,17,22H,4-5,7-8,10-11H2,1H3,(H2,21,23);2*1H |
| InChIKey | NAUGLCGXQTUMNB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|