C25H35NOSi — CID 71484917
[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 71484917) has the molecular formula C25H35NOSi and a molecular weight of 393.65 g/mol. Its IUPAC name is [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 71484917 |
| Molecular Formula | C25H35NOSi |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H]1CCCN2CCCC[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35NOSi/c1-25(2,3)28(21-13-6-4-7-14-21,22-15-8-5-9-16-22)27-24-18-12-20-26-19-11-10-17-23(24)26/h4-9,13-16,23-24H,10-12,17-20H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | SUIHVWSGTOXLMS-RPWUZVMVSA-N |
| XLogP | 4.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|