C18H29N4O5P — CID 71485013
(3aR,4R,7aS)-2-(6-azidohexyl)-4-diethoxyphosphoryl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 71485013) has the molecular formula C18H29N4O5P and a molecular weight of 412.43 g/mol. Its IUPAC name is (3aR,4R,7aS)-2-(6-azidohexyl)-4-diethoxyphosphoryl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7aS)-2-(6-azidohexyl)-4-diethoxyphosphoryl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 71485013 |
| Molecular Formula | C18H29N4O5P |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3aR,4R,7aS)-2-(6-azidohexyl)-4-diethoxyphosphoryl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCOP(=O)(OCC)[C@@H]1C=CC[C@@H]2C(=O)N(CCCCCCN=[N+]=[N-])C(=O)[C@@H]21 |
| InChI | InChI=1S/C18H29N4O5P/c1-3-26-28(25,27-4-2)15-11-9-10-14-16(15)18(24)22(17(14)23)13-8-6-5-7-12-20-21-19/h9,11,14-16H,3-8,10,12-13H2,1-2H3/t14-,15+,16-/m0/s1 |
| InChIKey | ROAKWHGAYAEPIT-XHSDSOJGSA-N |
| XLogP | 4.05 |
| TPSA | 121.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|