C10H15F3O — CID 71485097
(3E,5E)-1,1,1-trifluorodeca-3,5-dien-2-ol (PubChem CID 71485097) has the molecular formula C10H15F3O and a molecular weight of 208.22 g/mol. Its IUPAC name is (3E,5E)-1,1,1-trifluorodeca-3,5-dien-2-ol.
| Compound Name | (3E,5E)-1,1,1-trifluorodeca-3,5-dien-2-ol |
|---|---|
| PubChem CID | 71485097 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3E,5E)-1,1,1-trifluorodeca-3,5-dien-2-ol |
| SMILES | CCCC/C=C/C=C/C(O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O/c1-2-3-4-5-6-7-8-9(14)10(11,12)13/h5-9,14H,2-4H2,1H3/b6-5+,8-7+ |
| InChIKey | JVUDLSOQSWFXOZ-BSWSSELBSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|