C14H15NO3 — CID 71485171
(3aS,4R,7S,7aR)-2-hex-5-ynyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 71485171) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-hex-5-ynyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-hex-5-ynyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 71485171 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-hex-5-ynyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C#CCCCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C14H15NO3/c1-2-3-4-5-8-15-13(16)11-9-6-7-10(18-9)12(11)14(15)17/h1,6-7,9-12H,3-5,8H2/t9-,10+,11-,12+ |
| InChIKey | VYNGXDIKBJXXCI-BKUVIOGVSA-N |
| XLogP | 0.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|