About 4-chloro-2,6-dimethoxybenzonitrile
4-chloro-2,6-dimethoxybenzonitrile (PubChem CID 71485579) has the molecular formula C9H8ClNO2
and a molecular weight of 197.62 g/mol. Its IUPAC name is 4-chloro-2,6-dimethoxybenzonitrile.
Molecular Properties
| Compound Name | 4-chloro-2,6-dimethoxybenzonitrile |
| PubChem CID | 71485579 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 4-chloro-2,6-dimethoxybenzonitrile |
| SMILES | COc1cc(Cl)cc(OC)c1C#N |
| InChI | InChI=1S/C9H8ClNO2/c1-12-8-3-6(10)4-9(13-2)7(8)5-11/h3-4H,1-2H3 |
| InChIKey | ZVZSOJCUKMHBOI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2,6-dimethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-dimethoxybenzonitrile?
The IUPAC name of 4-chloro-2,6-dimethoxybenzonitrile (CID 71485579) is 4-chloro-2,6-dimethoxybenzonitrile.
What is the SMILES notation for 4-chloro-2,6-dimethoxybenzonitrile?
The canonical SMILES for 4-chloro-2,6-dimethoxybenzonitrile is COc1cc(Cl)cc(OC)c1C#N.
What is the InChIKey of 4-chloro-2,6-dimethoxybenzonitrile?
The InChIKey is ZVZSOJCUKMHBOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2/c1-12-8-3-6(10)4-9(13-2)7(8)5-11/h3-4H,1-2H3.
What are the key properties of 4-chloro-2,6-dimethoxybenzonitrile?
4-chloro-2,6-dimethoxybenzonitrile has a molecular weight of 197.62 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-dimethoxybenzonitrile is sourced from PubChem (CID 71485579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).