C22H17N5O2S — CID 71485591
8-benzyl-5-methyl-7-oxo-12-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraene-4-carboxamide (PubChem CID 71485591) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 8-benzyl-5-methyl-7-oxo-12-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraene-4-carboxamide.
| Compound Name | 8-benzyl-5-methyl-7-oxo-12-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 71485591 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 8-benzyl-5-methyl-7-oxo-12-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraene-4-carboxamide |
| SMILES | Cc1c(C(N)=O)sc2c1c(=O)n(Cc1ccccc1)c1nnc(-c3ccccc3)n21 |
| InChI | InChI=1S/C22H17N5O2S/c1-13-16-20(29)26(12-14-8-4-2-5-9-14)22-25-24-19(15-10-6-3-7-11-15)27(22)21(16)30-17(13)18(23)28/h2-11H,12H2,1H3,(H2,23,28) |
| InChIKey | WDEQCFGQGQUAKD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |