About 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane
2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane (PubChem CID 71486230) has the molecular formula C24H24Br2Si2
and a molecular weight of 528.44 g/mol. Its IUPAC name is 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane |
| PubChem CID | 71486230 |
| Molecular Formula | C24H24Br2Si2 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1cc2cc3cc(Br)c(C#C[Si](C)(C)C)cc3cc2cc1Br |
| InChI | InChI=1S/C24H24Br2Si2/c1-27(2,3)9-7-17-11-19-13-22-16-24(26)18(8-10-28(4,5)6)12-20(22)14-21(19)15-23(17)25/h11-16H,1-6H3 |
| InChIKey | WNQMKWQXLWFYRO-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane?
The IUPAC name of 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane (CID 71486230) is 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane is C[Si](C)(C)C#Cc1cc2cc3cc(Br)c(C#C[Si](C)(C)C)cc3cc2cc1Br.
What is the InChIKey of 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane?
The InChIKey is WNQMKWQXLWFYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Br2Si2/c1-27(2,3)9-7-17-11-19-13-22-16-24(26)18(8-10-28(4,5)6)12-20(22)14-21(19)15-23(17)25/h11-16H,1-6H3.
What are the key properties of 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane?
2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane has a molecular weight of 528.44 g/mol, XLogP of 7.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,7-dibromo-6-(2-trimethylsilylethynyl)anthracen-2-yl]ethynyl-trimethylsilane is sourced from PubChem (CID 71486230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).