C20H32O5Si — CID 71486241
2-[(Z)-3-(methoxymethoxy)-2-methyl-7-trimethylsilylhept-5-en-2-yl]oxy-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 71486241) has the molecular formula C20H32O5Si and a molecular weight of 380.56 g/mol. Its IUPAC name is 2-[(Z)-3-(methoxymethoxy)-2-methyl-7-trimethylsilylhept-5-en-2-yl]oxy-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(Z)-3-(methoxymethoxy)-2-methyl-7-trimethylsilylhept-5-en-2-yl]oxy-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 71486241 |
| Molecular Formula | C20H32O5Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[(Z)-3-(methoxymethoxy)-2-methyl-7-trimethylsilylhept-5-en-2-yl]oxy-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COCOC(C/C=C\C[Si](C)(C)C)C(C)(C)OC1=CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C20H32O5Si/c1-15-12-17(22)18(13-16(15)21)25-20(2,3)19(24-14-23-4)10-8-9-11-26(5,6)7/h8-9,12-13,19H,10-11,14H2,1-7H3/b9-8- |
| InChIKey | VALCSXQCAAIMOK-HJWRWDBZSA-N |
| XLogP | 4.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|