C26H25ClN4O4S — CID 71486298
1-[[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]amino]-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 71486298) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is 1-[[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]amino]-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-[[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]amino]-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 71486298 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 1-[[1-[(4-chlorophenyl)methyl]indole-3-carbonyl]amino]-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)NNC(=O)c2cn(Cc3ccc(Cl)cc3)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H25ClN4O4S/c1-33-22-12-18(13-23(34-2)24(22)35-3)28-26(36)30-29-25(32)20-15-31(21-7-5-4-6-19(20)21)14-16-8-10-17(27)11-9-16/h4-13,15H,14H2,1-3H3,(H,29,32)(H2,28,30,36) |
| InChIKey | JIUYCWCHYAAOQG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|