About N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride
N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride (PubChem CID 71486408) has the molecular formula C18H24Cl2N4S
and a molecular weight of 399.39 g/mol. Its IUPAC name is N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride |
| PubChem CID | 71486408 |
| Molecular Formula | C18H24Cl2N4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\c1ccc2c(c1)CCN2C1CCCNC1)c1cccs1 |
| InChI | InChI=1S/C18H22N4S.2ClH/c19-18(17-4-2-10-23-17)21-14-5-6-16-13(11-14)7-9-22(16)15-3-1-8-20-12-15;;/h2,4-6,10-11,15,20H,1,3,7-9,12H2,(H2,19,21);2*1H |
| InChIKey | WAIKTIFJOLZDCZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride?
The IUPAC name of N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride (CID 71486408) is N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride.
What is the SMILES notation for N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride?
The canonical SMILES for N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride is Cl.Cl.N/C(=N\c1ccc2c(c1)CCN2C1CCCNC1)c1cccs1.
What is the InChIKey of N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride?
The InChIKey is WAIKTIFJOLZDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4S.2ClH/c19-18(17-4-2-10-23-17)21-14-5-6-16-13(11-14)7-9-22(16)15-3-1-8-20-12-15;;/h2,4-6,10-11,15,20H,1,3,7-9,12H2,(H2,19,21);2*1H.
What are the key properties of N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride?
N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride has a molecular weight of 399.39 g/mol, XLogP of 3.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-piperidin-3-yl-2,3-dihydroindol-5-yl)thiophene-2-carboximidamide;dihydrochloride is sourced from PubChem (CID 71486408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).