About [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine
[(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine (PubChem CID 71486419) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine |
| PubChem CID | 71486419 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine |
| SMILES | COc1ccc(CO/N=C2\CNCC2CN)c(OC)c1OC |
| InChI | InChI=1S/C15H23N3O4/c1-19-13-5-4-10(14(20-2)15(13)21-3)9-22-18-12-8-17-7-11(12)6-16/h4-5,11,17H,6-9,16H2,1-3H3/b18-12+ |
| InChIKey | XWEVSGMYIMERFF-LDADJPATSA-N |
| XLogP | 0.76 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine?
The IUPAC name of [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine (CID 71486419) is [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine?
The canonical SMILES for [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine is COc1ccc(CO/N=C2\CNCC2CN)c(OC)c1OC.
What is the InChIKey of [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine?
The InChIKey is XWEVSGMYIMERFF-LDADJPATSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-19-13-5-4-10(14(20-2)15(13)21-3)9-22-18-12-8-17-7-11(12)6-16/h4-5,11,17H,6-9,16H2,1-3H3/b18-12+.
What are the key properties of [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine?
[(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine has a molecular weight of 309.37 g/mol, XLogP of 0.76, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-4-[(2,3,4-trimethoxyphenyl)methoxyimino]pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 71486419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).