C20H40O3Si — CID 71486540
methyl (E)-3-propyl-4-triethylsilyloxydec-2-enoate (PubChem CID 71486540) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is methyl (E)-3-propyl-4-triethylsilyloxydec-2-enoate.
| Compound Name | methyl (E)-3-propyl-4-triethylsilyloxydec-2-enoate |
|---|---|
| PubChem CID | 71486540 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | methyl (E)-3-propyl-4-triethylsilyloxydec-2-enoate |
| SMILES | CCCCCCC(O[Si](CC)(CC)CC)/C(=C/C(=O)OC)CCC |
| InChI | InChI=1S/C20H40O3Si/c1-7-12-13-14-16-19(23-24(9-3,10-4)11-5)18(15-8-2)17-20(21)22-6/h17,19H,7-16H2,1-6H3/b18-17+ |
| InChIKey | KMYCEGGIQWWWHT-ISLYRVAYSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|