C19H22N4O2S — CID 71486816
N-cyclohexyl-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine (PubChem CID 71486816) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-cyclohexyl-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine.
| Compound Name | N-cyclohexyl-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine |
|---|---|
| PubChem CID | 71486816 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-cyclohexyl-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine |
| SMILES | C=CCN1c2ccccc2-c2nc(NC3CCCCC3)ncc2S1(=O)=O |
| InChI | InChI=1S/C19H22N4O2S/c1-2-12-23-16-11-7-6-10-15(16)18-17(26(23,24)25)13-20-19(22-18)21-14-8-4-3-5-9-14/h2,6-7,10-11,13-14H,1,3-5,8-9,12H2,(H,20,21,22) |
| InChIKey | XPVHUFAOOIKVNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|