About 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid
3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid (PubChem CID 71486992) has the molecular formula C14H20Cl2NO5P
and a molecular weight of 384.20 g/mol. Its IUPAC name is 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid.
Molecular Properties
| Compound Name | 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid |
| PubChem CID | 71486992 |
| Molecular Formula | C14H20Cl2NO5P |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CCCN(OCc1ccc(Cl)c(Cl)c1)C(C)=O |
| InChI | InChI=1S/C14H20Cl2NO5P/c1-3-22-23(19,20)8-4-7-17(11(2)18)21-10-12-5-6-13(15)14(16)9-12/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,19,20) |
| InChIKey | NTUSABPUESEGSH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid?
The IUPAC name of 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid (CID 71486992) is 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid.
What is the SMILES notation for 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid?
The canonical SMILES for 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid is CCOP(=O)(O)CCCN(OCc1ccc(Cl)c(Cl)c1)C(C)=O.
What is the InChIKey of 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid?
The InChIKey is NTUSABPUESEGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2NO5P/c1-3-22-23(19,20)8-4-7-17(11(2)18)21-10-12-5-6-13(15)14(16)9-12/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,19,20).
What are the key properties of 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid?
3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid has a molecular weight of 384.20 g/mol, XLogP of 3.89, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[acetyl-[(3,4-dichlorophenyl)methoxy]amino]propyl-ethoxyphosphinic acid is sourced from PubChem (CID 71486992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).