C27H22N6O2S — CID 71487003
N-[4-(1-methylbenzimidazol-2-yl)phenyl]-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine (PubChem CID 71487003) has the molecular formula C27H22N6O2S and a molecular weight of 494.58 g/mol. Its IUPAC name is N-[4-(1-methylbenzimidazol-2-yl)phenyl]-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine.
| Compound Name | N-[4-(1-methylbenzimidazol-2-yl)phenyl]-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine |
|---|---|
| PubChem CID | 71487003 |
| Molecular Formula | C27H22N6O2S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[4-(1-methylbenzimidazol-2-yl)phenyl]-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine |
| SMILES | C=CCN1c2ccccc2-c2nc(Nc3ccc(-c4nc5ccccc5n4C)cc3)ncc2S1(=O)=O |
| InChI | InChI=1S/C27H22N6O2S/c1-3-16-33-22-10-6-4-8-20(22)25-24(36(33,34)35)17-28-27(31-25)29-19-14-12-18(13-15-19)26-30-21-9-5-7-11-23(21)32(26)2/h3-15,17H,1,16H2,2H3,(H,28,29,31) |
| InChIKey | GAZQHNJBUCOBKQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|