About (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide
(2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide (PubChem CID 71487657) has the molecular formula C18H17Cl2N3O2
and a molecular weight of 378.26 g/mol. Its IUPAC name is (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide.
Molecular Properties
| Compound Name | (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide |
| PubChem CID | 71487657 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide |
| SMILES | CC[C@@H](Oc1ncc(Cl)cc1Cl)C(=O)NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-2-16(25-18-14(20)8-13(19)10-23-18)17(24)22-9-11-3-4-15-12(7-11)5-6-21-15/h3-8,10,16,21H,2,9H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | SLSYMFIQOLTDDZ-MRXNPFEDSA-N |
| XLogP | 4.34 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide?
The IUPAC name of (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide (CID 71487657) is (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide.
What is the SMILES notation for (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide?
The canonical SMILES for (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide is CC[C@@H](Oc1ncc(Cl)cc1Cl)C(=O)NCc1ccc2[nH]ccc2c1.
What is the InChIKey of (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide?
The InChIKey is SLSYMFIQOLTDDZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H17Cl2N3O2/c1-2-16(25-18-14(20)8-13(19)10-23-18)17(24)22-9-11-3-4-15-12(7-11)5-6-21-15/h3-8,10,16,21H,2,9H2,1H3,(H,22,24)/t16-/m1/s1.
What are the key properties of (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide?
(2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide has a molecular weight of 378.26 g/mol, XLogP of 4.34, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]-N-(1H-indol-5-ylmethyl)butanamide is sourced from PubChem (CID 71487657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).