C10H18N6O2 — CID 71487731
1-N,4-N-diethyl-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide (PubChem CID 71487731) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-N,4-N-diethyl-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-diethyl-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 71487731 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-N,4-N-diethyl-3,6-dimethyl-1,2,4,5-tetrazine-1,4-dicarboxamide |
| SMILES | CCNC(=O)N1N=C(C)N(C(=O)NCC)N=C1C |
| InChI | InChI=1S/C10H18N6O2/c1-5-11-9(17)15-7(3)14-16(8(4)13-15)10(18)12-6-2/h5-6H2,1-4H3,(H,11,17)(H,12,18) |
| InChIKey | DXCNQKUJGQNTGW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |