C20H17F3N2O4 — CID 71487806
N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide (PubChem CID 71487806) has the molecular formula C20H17F3N2O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 71487806 |
| Molecular Formula | C20H17F3N2O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H17F3N2O4/c1-9(2)10-6-7-11-14(8-10)29-19(28)12-4-3-5-13(24)15(12)16(26)18(11,19)25-17(27)20(21,22)23/h3-9,28H,24H2,1-2H3,(H,25,27) |
| InChIKey | ZCJVHHKOYLKRHX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|