C27H22Cl2N2O4 — CID 71487862
(E)-N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 71487862) has the molecular formula C27H22Cl2N2O4 and a molecular weight of 509.39 g/mol. Its IUPAC name is (E)-N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 71487862 |
| Molecular Formula | C27H22Cl2N2O4 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | (E)-N-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H22Cl2N2O4/c1-14(2)16-8-9-17-22(13-16)35-27(34)18-4-3-5-21(30)24(18)25(33)26(17,27)31-23(32)11-7-15-6-10-19(28)20(29)12-15/h3-14,34H,30H2,1-2H3,(H,31,32)/b11-7+ |
| InChIKey | OCAHBJHDWWWMJE-YRNVUSSQSA-N |
| XLogP | 5.16 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|