C17H29NO4 — CID 71487962
1-[(7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-4-yl]ethanone (PubChem CID 71487962) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 1-[(7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-4-yl]ethanone.
| Compound Name | 1-[(7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-4-yl]ethanone |
|---|---|
| PubChem CID | 71487962 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-[(7E,9S,10S,11R,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-4-yl]ethanone |
| SMILES | CO[C@H]1/C=C/CCN(C(C)=O)CCOC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H29NO4/c1-13-11-14(2)17(20)16(21-4)7-5-6-8-18(15(3)19)9-10-22-12-13/h5,7,11,14,16-17,20H,6,8-10,12H2,1-4H3/b7-5+,13-11-/t14-,16+,17+/m1/s1 |
| InChIKey | MKRJKMLUGKTAMM-LJKLGTANSA-N |
| XLogP | 1.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|