C26H18ClF3N6O3S — CID 71487992
(1Z)-1-[3-(2-chloro-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 71487992) has the molecular formula C26H18ClF3N6O3S and a molecular weight of 586.98 g/mol. Its IUPAC name is (1Z)-1-[3-(2-chloro-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | (1Z)-1-[3-(2-chloro-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 71487992 |
| Molecular Formula | C26H18ClF3N6O3S |
| Molecular Weight | 586.98 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | (1Z)-1-[3-(2-chloro-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | Cc1cccc(Cl)c1N1C(=O)CS/C1=N\C(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H18ClF3N6O3S/c1-15-3-2-4-20(27)22(15)36-21(37)13-40-25(36)33-24(38)32-17-7-5-16(6-8-17)23-31-14-35(34-23)18-9-11-19(12-10-18)39-26(28,29)30/h2-12,14H,13H2,1H3,(H,32,38)/b33-25- |
| InChIKey | SKTSFGWZNNCTFX-IVQJCJPDSA-N |
| XLogP | 6.46 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.98 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|