C14H20FN3O6 — CID 71488098
[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino] 3-methylbutanoate (PubChem CID 71488098) has the molecular formula C14H20FN3O6 and a molecular weight of 345.33 g/mol. Its IUPAC name is [[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino] 3-methylbutanoate.
| Compound Name | [[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino] 3-methylbutanoate |
|---|---|
| PubChem CID | 71488098 |
| Molecular Formula | C14H20FN3O6 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]amino] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)ONc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C14H20FN3O6/c1-6(2)4-9(19)24-17-12-8(15)5-18(14(22)16-12)13-11(21)10(20)7(3)23-13/h5-7,10-11,13,20-21H,4H2,1-3H3,(H,16,17,22)/t7-,10-,11-,13-/m1/s1 |
| InChIKey | MPOAMPLVMBQFOV-GDECHXLSSA-N |
| XLogP | -0.06 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|