C22H39NO4 — CID 71488222
tert-butyl N-[(1S,4Z,6R,7S,8S,9E)-7-hydroxy-8-methoxy-4,6-dimethylcyclotetradeca-4,9-dien-1-yl]carbamate (PubChem CID 71488222) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is tert-butyl N-[(1S,4Z,6R,7S,8S,9E)-7-hydroxy-8-methoxy-4,6-dimethylcyclotetradeca-4,9-dien-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4Z,6R,7S,8S,9E)-7-hydroxy-8-methoxy-4,6-dimethylcyclotetradeca-4,9-dien-1-yl]carbamate |
|---|---|
| PubChem CID | 71488222 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | tert-butyl N-[(1S,4Z,6R,7S,8S,9E)-7-hydroxy-8-methoxy-4,6-dimethylcyclotetradeca-4,9-dien-1-yl]carbamate |
| SMILES | CO[C@H]1/C=C/CCCC[C@H](NC(=O)OC(C)(C)C)CC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C22H39NO4/c1-16-13-14-18(23-21(25)27-22(3,4)5)11-9-7-8-10-12-19(26-6)20(24)17(2)15-16/h10,12,15,17-20,24H,7-9,11,13-14H2,1-6H3,(H,23,25)/b12-10+,16-15-/t17-,18+,19+,20+/m1/s1 |
| InChIKey | MNVXOEBCHAZZMU-QWGZDHEYSA-N |
| XLogP | 4.75 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|