C17H32ClNO2 — CID 71488224
(1S,2R,3Z,7S,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol;hydrochloride (PubChem CID 71488224) has the molecular formula C17H32ClNO2 and a molecular weight of 317.90 g/mol. Its IUPAC name is (1S,2R,3Z,7S,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol;hydrochloride.
| Compound Name | (1S,2R,3Z,7S,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol;hydrochloride |
|---|---|
| PubChem CID | 71488224 |
| Molecular Formula | C17H32ClNO2 |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (1S,2R,3Z,7S,12E,14S)-7-amino-14-methoxy-2,4-dimethylcyclotetradeca-3,12-dien-1-ol;hydrochloride |
| SMILES | CO[C@H]1/C=C/CCCC[C@H](N)CC/C(C)=C\[C@@H](C)[C@@H]1O.Cl |
| InChI | InChI=1S/C17H31NO2.ClH/c1-13-10-11-15(18)8-6-4-5-7-9-16(20-3)17(19)14(2)12-13;/h7,9,12,14-17,19H,4-6,8,10-11,18H2,1-3H3;1H/b9-7+,13-12-;/t14-,15+,16+,17+;/m1./s1 |
| InChIKey | KWBRLQGOZDILHA-QUZPWSJBSA-N |
| XLogP | 3.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|