C23H20F2N4O3S3 — CID 71488422
[4-[(2S)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[[5-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 71488422) has the molecular formula C23H20F2N4O3S3 and a molecular weight of 534.64 g/mol. Its IUPAC name is [4-[(2S)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[[5-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[[5-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 71488422 |
| Molecular Formula | C23H20F2N4O3S3 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | [4-[(2S)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[[5-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | O=S(=O)(O)Nc1ccc(C[C@H](Nc2ncc(-c3ccc(F)cc3F)s2)c2nc(C3CC3)cs2)cc1 |
| InChI | InChI=1S/C23H20F2N4O3S3/c24-15-5-8-17(18(25)10-15)21-11-26-23(34-21)28-19(22-27-20(12-33-22)14-3-4-14)9-13-1-6-16(7-2-13)29-35(30,31)32/h1-2,5-8,10-12,14,19,29H,3-4,9H2,(H,26,28)(H,30,31,32)/t19-/m0/s1 |
| InChIKey | XMOPZKWNEIUEPO-IBGZPJMESA-N |
| XLogP | 6.03 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|