About 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one
6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one (PubChem CID 71488536) has the molecular formula C19H18O4
and a molecular weight of 310.35 g/mol. Its IUPAC name is 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one.
Molecular Properties
| Compound Name | 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one |
| PubChem CID | 71488536 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one |
| SMILES | CC(C)(C)c1cccc2c1OC1(O)c3ccccc3C(=O)C21O |
| InChI | InChI=1S/C19H18O4/c1-17(2,3)13-9-6-10-14-15(13)23-19(22)12-8-5-4-7-11(12)16(20)18(14,19)21/h4-10,21-22H,1-3H3 |
| InChIKey | CJTLJVAPCUTPBZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
The IUPAC name of 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one (CID 71488536) is 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one.
What is the SMILES notation for 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
The canonical SMILES for 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one is CC(C)(C)c1cccc2c1OC1(O)c3ccccc3C(=O)C21O.
What is the InChIKey of 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
The InChIKey is CJTLJVAPCUTPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-17(2,3)13-9-6-10-14-15(13)23-19(22)12-8-5-4-7-11(12)16(20)18(14,19)21/h4-10,21-22H,1-3H3.
What are the key properties of 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one has a molecular weight of 310.35 g/mol, XLogP of 2.61, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one is sourced from PubChem (CID 71488536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).