C20H22O2 — CID 71488584
5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]-2-propan-2-ylbenzene-1,3-diol (PubChem CID 71488584) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]-2-propan-2-ylbenzene-1,3-diol.
| Compound Name | 5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]-2-propan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 71488584 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 5-[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]-2-propan-2-ylbenzene-1,3-diol |
| SMILES | Cc1ccc(/C=C/C=C/c2cc(O)c(C(C)C)c(O)c2)cc1 |
| InChI | InChI=1S/C20H22O2/c1-14(2)20-18(21)12-17(13-19(20)22)7-5-4-6-16-10-8-15(3)9-11-16/h4-14,21-22H,1-3H3/b6-4+,7-5+ |
| InChIKey | LKNISPQNZZMHEE-YDFGWWAZSA-N |
| XLogP | 5.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|