C26H29N7O2S — CID 71488630
4-[8-amino-3-(4-hydroxycyclohexyl)imidazo[1,5-a]pyrazin-1-yl]-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide (PubChem CID 71488630) has the molecular formula C26H29N7O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is 4-[8-amino-3-(4-hydroxycyclohexyl)imidazo[1,5-a]pyrazin-1-yl]-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide.
| Compound Name | 4-[8-amino-3-(4-hydroxycyclohexyl)imidazo[1,5-a]pyrazin-1-yl]-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 71488630 |
| Molecular Formula | C26H29N7O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 4-[8-amino-3-(4-hydroxycyclohexyl)imidazo[1,5-a]pyrazin-1-yl]-N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide |
| SMILES | CN1CCc2nc(NC(=O)c3ccc(-c4nc(C5CCC(O)CC5)n5ccnc(N)c45)cc3)sc2C1 |
| InChI | InChI=1S/C26H29N7O2S/c1-32-12-10-19-20(14-32)36-26(29-19)31-25(35)17-4-2-15(3-5-17)21-22-23(27)28-11-13-33(22)24(30-21)16-6-8-18(34)9-7-16/h2-5,11,13,16,18,34H,6-10,12,14H2,1H3,(H2,27,28)(H,29,31,35) |
| InChIKey | NRIOQGSHECFOLI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |