C32H33F12N10O6P — CID 71488682
bis((3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one);phosphoric acid (PubChem CID 71488682) has the molecular formula C32H33F12N10O6P and a molecular weight of 912.63 g/mol. Its IUPAC name is bis((3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one);phosphoric acid.
| Compound Name | bis((3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one);phosphoric acid |
|---|---|
| PubChem CID | 71488682 |
| Molecular Formula | C32H33F12N10O6P |
| Molecular Weight | 912.63 g/mol |
| Exact Mass | 912.21 |
| IUPAC Name | bis((3R)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one);phosphoric acid |
| SMILES | N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F.N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F.O=P(O)(O)O |
| InChI | InChI=1S/2C16H15F6N5O.H3O4P/c2*17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22;1-5(2,3)4/h2*4,6,9H,1-3,5,7,23H2;(H3,1,2,3,4)/t2*9-;/m11./s1 |
| InChIKey | FNSBNGSGGFOPKC-GRDVFPNISA-N |
| XLogP | 3.10 |
| TPSA | 231.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|