C21H21N3O2 — CID 71489182
(1S,10R)-1,16-dimethyl-14-phenyl-8,12-dioxa-14,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17),15-pentaen-4-amine (PubChem CID 71489182) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (1S,10R)-1,16-dimethyl-14-phenyl-8,12-dioxa-14,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17),15-pentaen-4-amine.
| Compound Name | (1S,10R)-1,16-dimethyl-14-phenyl-8,12-dioxa-14,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17),15-pentaen-4-amine |
|---|---|
| PubChem CID | 71489182 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (1S,10R)-1,16-dimethyl-14-phenyl-8,12-dioxa-14,15-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17),15-pentaen-4-amine |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@]1(C)c3cc(N)ccc3OC[C@@H]1CO2 |
| InChI | InChI=1S/C21H21N3O2/c1-13-19-20(24(23-13)16-6-4-3-5-7-16)26-12-14-11-25-18-9-8-15(22)10-17(18)21(14,19)2/h3-10,14H,11-12,22H2,1-2H3/t14-,21+/m1/s1 |
| InChIKey | SVTIHCFUQJWWNG-SZNDQCEHSA-N |
| XLogP | 3.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|