C23H46O4Si2 — CID 71489545
(2Z,4S,5R,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(oxan-2-yloxy)-8-trimethylsilylocta-2,7-dien-4-ol (PubChem CID 71489545) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is (2Z,4S,5R,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(oxan-2-yloxy)-8-trimethylsilylocta-2,7-dien-4-ol.
| Compound Name | (2Z,4S,5R,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(oxan-2-yloxy)-8-trimethylsilylocta-2,7-dien-4-ol |
|---|---|
| PubChem CID | 71489545 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (2Z,4S,5R,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-(oxan-2-yloxy)-8-trimethylsilylocta-2,7-dien-4-ol |
| SMILES | C[C@H]([C@@H](O)/C=C\COC1CCCCO1)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si2/c1-19(20(24)13-12-17-26-22-14-10-11-16-25-22)21(15-18-28(5,6)7)27-29(8,9)23(2,3)4/h12-13,15,18-22,24H,10-11,14,16-17H2,1-9H3/b13-12-,18-15+/t19-,20+,21-,22?/m1/s1 |
| InChIKey | LLOCUJVBVJENHG-ZOBMSFSMSA-N |
| XLogP | 5.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|