C24H48O3Si2 — CID 71489546
tert-butyl-[(1E,3S,4R,5E,7R)-4,7-dimethyl-8-(oxan-2-yloxy)-1-trimethylsilylocta-1,5-dien-3-yl]oxy-dimethylsilane (PubChem CID 71489546) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is tert-butyl-[(1E,3S,4R,5E,7R)-4,7-dimethyl-8-(oxan-2-yloxy)-1-trimethylsilylocta-1,5-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3S,4R,5E,7R)-4,7-dimethyl-8-(oxan-2-yloxy)-1-trimethylsilylocta-1,5-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 71489546 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | tert-butyl-[(1E,3S,4R,5E,7R)-4,7-dimethyl-8-(oxan-2-yloxy)-1-trimethylsilylocta-1,5-dien-3-yl]oxy-dimethylsilane |
| SMILES | C[C@H](/C=C/[C@@H](C)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)COC1CCCCO1 |
| InChI | InChI=1S/C24H48O3Si2/c1-20(19-26-23-13-11-12-17-25-23)14-15-21(2)22(16-18-28(6,7)8)27-29(9,10)24(3,4)5/h14-16,18,20-23H,11-13,17,19H2,1-10H3/b15-14+,18-16+/t20-,21-,22-,23?/m1/s1 |
| InChIKey | JYGLVYIRJDRVRL-SSAQFKKCSA-N |
| XLogP | 7.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|