C31H38O5Si — CID 71489604
methyl 2-[(2S,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]acetate (PubChem CID 71489604) has the molecular formula C31H38O5Si and a molecular weight of 518.73 g/mol. Its IUPAC name is methyl 2-[(2S,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 71489604 |
| Molecular Formula | C31H38O5Si |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | methyl 2-[(2S,4S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C31H38O5Si/c1-31(2,3)37(27-16-10-6-11-17-27,28-18-12-7-13-19-28)34-21-20-25-22-26(23-29(32)33-4)36-30(35-25)24-14-8-5-9-15-24/h5-19,25-26,30H,20-23H2,1-4H3/t25-,26-,30-/m0/s1 |
| InChIKey | CYQWSRANYDVAQA-JCGRVDTESA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|