C32H50O3Si2 — CID 71489703
tert-butyl-[2-[(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enyloxan-2-yl]ethoxy]-diphenylsilane (PubChem CID 71489703) has the molecular formula C32H50O3Si2 and a molecular weight of 538.92 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enyloxan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enyloxan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71489703 |
| Molecular Formula | C32H50O3Si2 |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | tert-butyl-[2-[(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enyloxan-2-yl]ethoxy]-diphenylsilane |
| SMILES | C=CC[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C32H50O3Si2/c1-10-17-26-24-28(35-36(8,9)31(2,3)4)25-27(34-26)22-23-33-37(32(5,6)7,29-18-13-11-14-19-29)30-20-15-12-16-21-30/h10-16,18-21,26-28H,1,17,22-25H2,2-9H3/t26-,27-,28+/m0/s1 |
| InChIKey | GXZPLMMCGMOACR-HZFUHODCSA-N |
| XLogP | 7.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|