C31H48O5Si2 — CID 71489704
2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetic acid (PubChem CID 71489704) has the molecular formula C31H48O5Si2 and a molecular weight of 556.89 g/mol. Its IUPAC name is 2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 71489704 |
| Molecular Formula | C31H48O5Si2 |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C31H48O5Si2/c1-30(2,3)37(7,8)36-26-21-24(35-25(22-26)23-29(32)33)19-20-34-38(31(4,5)6,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,24-26H,19-23H2,1-8H3,(H,32,33)/t24-,25+,26-/m0/s1 |
| InChIKey | YFJGULGDQZTLGX-NXCFDTQHSA-N |
| XLogP | 6.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|