C12H18O4 — CID 71489708
(1S,5R,7S)-7-[(2S)-2-hydroxypent-4-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 71489708) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1S,5R,7S)-7-[(2S)-2-hydroxypent-4-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1S,5R,7S)-7-[(2S)-2-hydroxypent-4-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 71489708 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1S,5R,7S)-7-[(2S)-2-hydroxypent-4-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | C=CC[C@H](O)C[C@H]1C[C@H]2C[C@H](CC(=O)O2)O1 |
| InChI | InChI=1S/C12H18O4/c1-2-3-8(13)4-9-5-10-6-11(15-9)7-12(14)16-10/h2,8-11,13H,1,3-7H2/t8-,9-,10-,11+/m0/s1 |
| InChIKey | MLHIYCHBWZLSGX-XWLWVQCSSA-N |
| XLogP | 1.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|