C36H72O3Si3 — CID 71489750
(8S,10S,11E,13R,14S,15E)-14-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-trimethylsilyl-8-tri(propan-2-yl)silyloxyhexadeca-1,11,15-trien-4-one (PubChem CID 71489750) has the molecular formula C36H72O3Si3 and a molecular weight of 637.23 g/mol. Its IUPAC name is (8S,10S,11E,13R,14S,15E)-14-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-trimethylsilyl-8-tri(propan-2-yl)silyloxyhexadeca-1,11,15-trien-4-one.
| Compound Name | (8S,10S,11E,13R,14S,15E)-14-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-trimethylsilyl-8-tri(propan-2-yl)silyloxyhexadeca-1,11,15-trien-4-one |
|---|---|
| PubChem CID | 71489750 |
| Molecular Formula | C36H72O3Si3 |
| Molecular Weight | 637.23 g/mol |
| Exact Mass | 636.48 |
| IUPAC Name | (8S,10S,11E,13R,14S,15E)-14-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-trimethylsilyl-8-tri(propan-2-yl)silyloxyhexadeca-1,11,15-trien-4-one |
| SMILES | C=CCC(=O)CCC[C@@H](C[C@H](C)/C=C/[C@@H](C)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H72O3Si3/c1-18-20-33(37)21-19-22-34(38-42(28(2)3,29(4)5)30(6)7)27-31(8)23-24-32(9)35(25-26-40(13,14)15)39-41(16,17)36(10,11)12/h18,23-26,28-32,34-35H,1,19-22,27H2,2-17H3/b24-23+,26-25+/t31-,32-,34+,35-/m1/s1 |
| InChIKey | ZXRLIRBXNFWVOY-QQTNNUESSA-N |
| XLogP | 11.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.23 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|