About dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate
dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate (PubChem CID 71490412) has the molecular formula C22H21ClN2O6
and a molecular weight of 444.87 g/mol. Its IUPAC name is dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate |
| PubChem CID | 71490412 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCON(c2cccc(Cl)c2)C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C22H21ClN2O6/c1-24-17-10-5-4-9-16(17)22(18(24)26)21(19(27)29-2,20(28)30-3)11-12-31-25(22)15-8-6-7-14(23)13-15/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | SZLHUUCKUJJIKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate?
The IUPAC name of dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate (CID 71490412) is dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate.
What is the SMILES notation for dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate?
The canonical SMILES for dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate is COC(=O)C1(C(=O)OC)CCON(c2cccc(Cl)c2)C12C(=O)N(C)c1ccccc12.
What is the InChIKey of dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate?
The InChIKey is SZLHUUCKUJJIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O6/c1-24-17-10-5-4-9-16(17)22(18(24)26)21(19(27)29-2,20(28)30-3)11-12-31-25(22)15-8-6-7-14(23)13-15/h4-10,13H,11-12H2,1-3H3.
What are the key properties of dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate?
dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate has a molecular weight of 444.87 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2'-(3-chlorophenyl)-1-methyl-2-oxospiro[indole-3,3'-oxazinane]-4',4'-dicarboxylate is sourced from PubChem (CID 71490412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).