C9H17F3N2O2 — CID 71490844
N-[(2S,3S)-1,1,1-trifluoro-3-nitrobutan-2-yl]pentan-1-amine (PubChem CID 71490844) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is N-[(2S,3S)-1,1,1-trifluoro-3-nitrobutan-2-yl]pentan-1-amine.
| Compound Name | N-[(2S,3S)-1,1,1-trifluoro-3-nitrobutan-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 71490844 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[(2S,3S)-1,1,1-trifluoro-3-nitrobutan-2-yl]pentan-1-amine |
| SMILES | CCCCCN[C@@H]([C@H](C)[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-3-4-5-6-13-8(9(10,11)12)7(2)14(15)16/h7-8,13H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | SJQSXDUDBHOEKJ-YUMQZZPRSA-N |
| XLogP | 2.36 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|