C16H20F5N3O3 — CID 71491292
N-[3-(methylcarbamoyl)pentan-3-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide (PubChem CID 71491292) has the molecular formula C16H20F5N3O3 and a molecular weight of 397.34 g/mol. Its IUPAC name is N-[3-(methylcarbamoyl)pentan-3-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-(methylcarbamoyl)pentan-3-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71491292 |
| Molecular Formula | C16H20F5N3O3 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[3-(methylcarbamoyl)pentan-3-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide |
| SMILES | CCC(CC)(NC(=O)c1cccc(OCC(F)(F)C(F)(F)F)n1)C(=O)NC |
| InChI | InChI=1S/C16H20F5N3O3/c1-4-14(5-2,13(26)22-3)24-12(25)10-7-6-8-11(23-10)27-9-15(17,18)16(19,20)21/h6-8H,4-5,9H2,1-3H3,(H,22,26)(H,24,25) |
| InChIKey | RJWZYQFETKFLMW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|